3-chloro-4-hydroxy-5-nitrobenzenesulphonic acid structure
|
Common Name | 3-chloro-4-hydroxy-5-nitrobenzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 83732-61-0 | Molecular Weight | 253.61700 | |
| Density | 1.886g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H4ClNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-4-hydroxy-5-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.886g/cm3 |
|---|---|
| Molecular Formula | C6H4ClNO6S |
| Molecular Weight | 253.61700 |
| Exact Mass | 252.94500 |
| PSA | 128.80000 |
| LogP | 2.80450 |
| Index of Refraction | 1.657 |
| InChIKey | VMHPZSMLWXYABA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)O)cc(Cl)c1O |
|
~%
3-chloro-4-hydr... CAS#:83732-61-0 |
| Literature: Armstrong; Brown Journal of the Chemical Society, 1872 , vol. 25, p. 870 Chem. Zentralbl., 1873 , vol. 44, p. 379 |
|
~%
3-chloro-4-hydr... CAS#:83732-61-0 |
| Literature: Armstrong Chemische Berichte, 1874 , vol. 7, p. 405 |
| 3-Chloro-4-hydroxy-5-nitrobenzenesulphonic acid |
| 3-chloro-4-hydroxy-5-nitro-benzenesulfonic acid |
| EINECS 280-610-3 |
| Benzenesulfonic acid,3-chloro-4-hydroxy-5-nitro |
| 3-Chlor-4-hydroxy-5-nitro-benzolsulfonsaeure |