Sodium 4,6-dihydroxy-2-naphthalenesulfonate structure
|
Common Name | Sodium 4,6-dihydroxy-2-naphthalenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 83732-66-5 | Molecular Weight | 262.214 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NaO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-Dihydroxynaphthalene-2-Sulfonic Acid Sodium Salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7NaO5S |
|---|---|
| Molecular Weight | 262.214 |
| Exact Mass | 261.991180 |
| PSA | 106.04000 |
| LogP | 2.23590 |
| InChIKey | KJIKTXVDOGQVIJ-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])c1cc(O)c2cc(O)ccc2c1.[Na+] |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| RTECS | CB3300000 |
| HS Code | 2908999090 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| Sodium 4,6-dihydroxy-2-naphthalenesulfonate |
| EINECS 280-616-6 |
| Sodium 4,6-Dihydroxynaphthalene-2-sulfonate |
| 2-Naphthalenesulfonic acid, 4,6-dihydroxy-, sodium salt (1:1) |
| Sodium 2,8-dihydroxynaphthalene-6-sulfonate |