2-(2,4-difluorophenyl)-6-fluoro-1,3-benzothiazole structure
|
Common Name | 2-(2,4-difluorophenyl)-6-fluoro-1,3-benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 837383-76-3 | Molecular Weight | 265.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6F3NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4-difluorophenyl)-6-fluoro-1,3-benzothiazole |
|---|
| Molecular Formula | C13H6F3NS |
|---|---|
| Molecular Weight | 265.25400 |
| Exact Mass | 265.01700 |
| PSA | 41.13000 |
| LogP | 4.38060 |
| InChIKey | REXXAHCOECBTQI-UHFFFAOYSA-N |
| SMILES | Fc1ccc(-c2nc3ccc(F)cc3s2)c(F)c1 |
|
~%
2-(2,4-difluoro... CAS#:837383-76-3 |
| Literature: Chang, Wei-Chieh; Hu, Andrew Teh; Duan, Jiun-Pey; Rayabarapu, Dinesh Kumar; Cheng, Chien-Hong Journal of Organometallic Chemistry, 2004 , vol. 689, # 26 p. 4882 - 4888 |
|
~%
2-(2,4-difluoro... CAS#:837383-76-3 |
| Literature: Chang, Wei-Chieh; Hu, Andrew Teh; Duan, Jiun-Pey; Rayabarapu, Dinesh Kumar; Cheng, Chien-Hong Journal of Organometallic Chemistry, 2004 , vol. 689, # 26 p. 4882 - 4888 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |