5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate structure
|
Common Name | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate | ||
|---|---|---|---|---|
| CAS Number | 83763-48-8 | Molecular Weight | 280.298 | |
| Density | N/A | Boiling Point | 600ºC at 760 mmHg | |
| Molecular Formula | C9H16N2O6S | Melting Point | 150-154ºC | |
| MSDS | N/A | Flash Point | 316.7ºC | |
| Name | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 600ºC at 760 mmHg |
|---|---|
| Melting Point | 150-154ºC |
| Molecular Formula | C9H16N2O6S |
| Molecular Weight | 280.298 |
| Flash Point | 316.7ºC |
| Exact Mass | 280.072906 |
| PSA | 150.49000 |
| LogP | 1.76380 |
| InChIKey | GWHLYFOWAINYAH-UHFFFAOYSA-N |
| SMILES | COc1ccc(NCCO)cc1N.O=S(=O)(O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(3-Amino-4-methoxyphenyl)amino]ethanolsulfat(salt) |
| 2-Amino-4-hydroxyethylaminoanisole sulfate |
| Ethanol, 2-[(3-amino-4-methoxyphenyl)amino]-, sulfate (1:1) (salt) |
| 2-Amino-4-hydroxyethylamino anisole sulfate |
| EINECS 280-734-8 |
| 2-(3-amino-4-methoxyanilino)ethanol,sulfuric acid |
| 2-[(3-Amino-4-methoxyphenyl)amino]ethanol sulfate (salt) |
| 2-[(3-Amino-4-methoxyphenyl)amino]ethanol sulfate (1:1) |
| MFCD00467095 |