4-[diazo(phenyl)methyl]benzonitrile structure
|
Common Name | 4-[diazo(phenyl)methyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 838-14-2 | Molecular Weight | 219.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[diazo(phenyl)methyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9N3 |
|---|---|
| Molecular Weight | 219.24100 |
| Exact Mass | 219.08000 |
| PSA | 61.18000 |
| LogP | 2.70654 |
| InChIKey | UYEKYZFWJXFZDQ-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=[N+]=[N-])c2ccccc2)cc1 |
|
~74%
4-[diazo(phenyl... CAS#:838-14-2 |
| Literature: Zimmerman, Howard E.; Suryanarayan, Vijay European Journal of Organic Chemistry, 2007 , # 24 p. 4091 - 4102 |
|
~%
4-[diazo(phenyl... CAS#:838-14-2 |
| Literature: Zimmerman, Howard E.; Suryanarayan, Vijay European Journal of Organic Chemistry, 2007 , # 24 p. 4091 - 4102 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Cyan-diphenyl-diazomethan |
| p-cyanodiphenyldiazomethane |
| 4-Cyan-phenyl-phenyl-diazomethan |