2-Naphthalenecarboxylicacid, 2-(3-methylbenzoyl)hydrazide structure
|
Common Name | 2-Naphthalenecarboxylicacid, 2-(3-methylbenzoyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 83803-96-7 | Molecular Weight | 304.34300 | |
| Density | 1.225g/cm3 | Boiling Point | 590.9ºC at 760 mmHg | |
| Molecular Formula | C19H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | N'-(3-methylbenzoyl)naphthalene-2-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 590.9ºC at 760 mmHg |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.34300 |
| Flash Point | 225.3ºC |
| Exact Mass | 304.12100 |
| PSA | 58.20000 |
| LogP | 4.00480 |
| Index of Refraction | 1.654 |
| InChIKey | NOZDWMYGSUBAEE-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)NNC(=O)c2ccc3ccccc3c2)c1 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00021628 |
| einecs 280-917-2 |
| 2-(1-naphthyl)-5-phenyl-1,3,4-oxadiazole |
| hms3092i09 |