Leukotriene A3 methyl ester (LTA3 methyl ester) structure
|
Common Name | Leukotriene A3 methyl ester (LTA3 methyl ester) | ||
|---|---|---|---|---|
| CAS Number | 83851-38-1 | Molecular Weight | 334.493 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 439.0±20.0 °C at 760 mmHg | |
| Molecular Formula | C21H34O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 166.6±6.7 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
Use of Leukotriene A3 methyl ester (LTA3 methyl ester)LTA3 as a free acid is highly unstable. The methyl ester is stable and can be readily hydrolyzed to the free acid as needed. |
| Name | leukotriene a3 methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.0±20.0 °C at 760 mmHg |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.493 |
| Flash Point | 166.6±6.7 °C |
| Exact Mass | 334.250793 |
| PSA | 38.83000 |
| LogP | 6.03 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | YOAQIJHBMIIBJM-CZVBCWTGSA-N |
| SMILES | CCCCCCCCC=CC=CC=CC1OC1CCCC(=O)OC |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H361f-H373-H411 |
| Precautionary Statements | P201-P210-P273-P301 + P310-P308 + P313-P331 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N |
| Risk Phrases | 11-38-48/20-51/53-62-65-67 |
| Safety Phrases | 36/37-61-62 |
| RIDADR | UN 1208 3/PG 2 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 4-{(2S,3S)-3-[(1E,3E,5Z)-1,3,5-tetradecatrien-1-yl]-2-oxiranyl}butanoate |
| 5S-TRANS-5,6-OXIDO-7E,9E,11Z-EICOSATRIENOIC ACID,METHYL ESTER |
| 2-Oxiranebutanoic acid, 3-[(1E,3E,5Z)-1,3,5-tetradecatrien-1-yl]-, methyl ester, (2S,3S)- |
| LTA3 METHYL ESTER |
| MFCD00065894 |
| 14,15-dihydro-LTA4 methyl ester |