dibenzofuran-2-sulfonic acid structure
|
Common Name | dibenzofuran-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 83863-63-2 | Molecular Weight | 248.25500 | |
| Density | 1.52 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H8O4S | Melting Point | 144-145°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dibenzo[b,d]furan-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52 g/cm3 |
|---|---|
| Melting Point | 144-145°C |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.25500 |
| Exact Mass | 248.01400 |
| PSA | 75.89000 |
| LogP | 3.91350 |
| InChIKey | JANFYPHFIPGYTQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2oc3ccccc3c2c1 |
| Risk Phrases | R34 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2932999099 |
|
~%
dibenzofuran-2-... CAS#:83863-63-2 |
| Literature: Journal of the American Chemical Society, , vol. 71, p. 1593 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 281-128-6 |
| dibenzofuran-2-sulfonic acid |
| MFCD00043577 |