L-Glutamine,N2-[(4-methylphenyl)sulfonyl]-N-propyl- structure
|
Common Name | L-Glutamine,N2-[(4-methylphenyl)sulfonyl]-N-propyl- | ||
|---|---|---|---|---|
| CAS Number | 83870-99-9 | Molecular Weight | 342.41100 | |
| Density | 1.255g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H22N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-methylphenyl)sulfonylamino]-5-oxo-5-(propylamino)pentanoic acid |
|---|
| Density | 1.255g/cm3 |
|---|---|
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.41100 |
| Exact Mass | 342.12500 |
| PSA | 120.95000 |
| LogP | 2.89550 |
| Index of Refraction | 1.545 |
| InChIKey | HGLUULUAORDIAX-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)O |
|
~66%
L-Glutamine,N2-... CAS#:83870-99-9 |
| Literature: De, A. U.; Pandey, Jiten; Majumdar, Anjali Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 5 p. 481 - 483 |
|
~%
L-Glutamine,N2-... CAS#:83870-99-9 |
| Literature: De, A. U.; Pandey, Jiten; Majumdar, Anjali Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 5 p. 481 - 483 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |