1,3,5-Tris(2-hydroxyethyl)cyanuric acid structure
|
Common Name | 1,3,5-Tris(2-hydroxyethyl)cyanuric acid | ||
|---|---|---|---|---|
| CAS Number | 839-90-7 | Molecular Weight | 261.232 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 526.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H15N3O6 | Melting Point | 136-140 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 272.3±28.7 °C | |
| Name | 1,3,5-Tris(2-hydroxyethyl)isocyanurate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 526.7±45.0 °C at 760 mmHg |
| Melting Point | 136-140 °C(lit.) |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.232 |
| Flash Point | 272.3±28.7 °C |
| Exact Mass | 261.096100 |
| PSA | 126.69000 |
| LogP | -4.80 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | BPXVHIRIPLPOPT-UHFFFAOYSA-N |
| SMILES | O=c1n(CCO)c(=O)n(CCO)c(=O)n1CCO |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29336980 |
|
~%
1,3,5-Tris(2-hy... CAS#:839-90-7 |
| Literature: Synthetic Communications, , vol. 23, # 19 p. 2659 - 2672 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|
Langmuir-blodgett films of supported polyester dendrimers.
ISRN Org. Chem. 2012 , 906839, (2013) Amphiphiles with a dendritic structure are attractive materials as they combine the features of dendrimers with the self-assembling properties and interfacial behavior of water-air affinities. We have... |
| 1,3,5-Tris(2-hydroxyethyl)isocyanuric acid |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3,5-tris(2-hydroxyethyl)- |
| 1,3,5-Tris(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| 1,3,5-Tris(2-hydroxyethyl)cyanuric acid |
| T6NVNVNVJ A2Q C2Q E2Q |
| MFCD00003549 |
| 1,3,5-Tris(2-hydroxyethyl)-1,3,5-triazine-2,4,6(1H,3H,5H)-trione |
| 1,3,5-Tris(2-hydroxyethyl)triazine-2,4,6-trione |
| EINECS 212-660-9 |