1-chloro-4-[4-chloro-1-(4-fluorophenyl)-1-butenyl]benzene structure
|
Common Name | 1-chloro-4-[4-chloro-1-(4-fluorophenyl)-1-butenyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 83929-31-1 | Molecular Weight | 295.17900 | |
| Density | 1.225g/cm3 | Boiling Point | 408.9ºC at 760 mmHg | |
| Molecular Formula | C16H13Cl2F | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.8ºC | |
| Name | 1-chloro-4-[4-chloro-1-(4-fluorophenyl)but-1-enyl]benzene |
|---|
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 408.9ºC at 760 mmHg |
| Molecular Formula | C16H13Cl2F |
| Molecular Weight | 295.17900 |
| Flash Point | 231.8ºC |
| Exact Mass | 294.03800 |
| LogP | 5.53970 |
| Index of Refraction | 1.574 |
| InChIKey | KGGHMPJQVZWWES-APQPDGGLSA-N |
| SMILES | Fc1ccc(C(=CCCCl)c2ccc(Cl)cc2)cc1 |
| HS Code | 2903999090 |
|---|
|
~%
1-chloro-4-[4-c... CAS#:83929-31-1 |
| Literature: Janssen Pharma. Patent: US3238216 , 1966 ; Chem.Abstr., 1966 , vol. 65, # 8922 |
|
~%
1-chloro-4-[4-c... CAS#:83929-31-1 |
| Literature: Janssen Pharma. Patent: US3238216 , 1966 ; Chem.Abstr., 1966 , vol. 65, # 8922 |
|
~%
1-chloro-4-[4-c... CAS#:83929-31-1 |
| Literature: Janssen Pharma. Patent: US3238216 , 1966 ; Chem.Abstr., 1966 , vol. 65, # 8922 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |