4-Fluorophenylmagnesium bromide structure
|
Common Name | 4-Fluorophenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 352-13-6 | Molecular Weight | 199.303 | |
| Density | 1.043 g/mL at 25ºC | Boiling Point | 66ºC | |
| Molecular Formula | C6H4BrFMg | Melting Point | 5ºC | |
| MSDS | N/A | Flash Point | -40 °F | |
| Name | magnesium,fluorobenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.043 g/mL at 25ºC |
|---|---|
| Boiling Point | 66ºC |
| Melting Point | 5ºC |
| Molecular Formula | C6H4BrFMg |
| Molecular Weight | 199.303 |
| Flash Point | -40 °F |
| Exact Mass | 197.933075 |
| LogP | 2.47150 |
| InChIKey | BRKADVNLTRCLOW-UHFFFAOYSA-M |
| SMILES | Fc1cc[c-]cc1.[Br-].[Mg+2] |
| Storage condition | Flammables + water-Freezer (-20°C)e area |
| Water Solubility | It reacts violently with water. |
| Hazard Codes | F+: Highly flammable;C: Corrosive;F: Flammable; |
|---|---|
| Risk Phrases | R12 |
| Safety Phrases | 16-26-36/37/39-43-45-7/8-33 |
| RIDADR | UN 2924 3 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
4-Fluorophenylm... CAS#:352-13-6 |
| Literature: Journal of Organometallic Chemistry, , vol. 654, # 1-2 p. 187 - 201 |
|
~%
4-Fluorophenylm... CAS#:352-13-6 |
| Literature: WO2004/80988 A1, ; Page 14 ; |
|
~%
4-Fluorophenylm... CAS#:352-13-6 |
| Literature: US6583287 B1, ; |
|
~%
4-Fluorophenylm... CAS#:352-13-6 |
| Literature: US4308378 A1, ; |
|
~%
4-Fluorophenylm... CAS#:352-13-6 |
| Literature: US6258842 B1, ; |
|
~%
4-Fluorophenylm... CAS#:352-13-6 |
| Literature: US6258842 B1, ; |
|
~%
4-Fluorophenylm... CAS#:352-13-6 |
| Literature: US4322563 A1, ; |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00009667 |
| 4-fluorophenylmagnesium bromide |
| 4-Fluorophenylmagnesiumbromide |
| 4-FC6H4MgBr |
| p-FC6H4MgBr |
| 4-Fluorophenylmagnesium bromide solution |
| Bromo(4-fluorophenyl)magnesium |
| p-Fluorophenylmagnesium bromide |
| 4-Fluorophenylmagnesium bromide |