2-[2-hydroxyethyl-[3-[(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)amino]propyl]amino]ethanol structure
|
Common Name | 2-[2-hydroxyethyl-[3-[(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)amino]propyl]amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 83948-13-4 | Molecular Weight | 436.54700 | |
| Density | 1.281g/cm3 | Boiling Point | 736.9ºC at 760mmHg | |
| Molecular Formula | C25H32N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 399.4ºC | |
| Name | 2-[2-hydroxyethyl-[3-[(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)amino]propyl]amino]ethanol |
|---|
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 736.9ºC at 760mmHg |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.54700 |
| Flash Point | 399.4ºC |
| Exact Mass | 436.24700 |
| PSA | 93.64000 |
| LogP | 3.65630 |
| Index of Refraction | 1.708 |
| InChIKey | IASFTLBWFHWYIA-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c3c(C)c4ccnc(NCCCN(CCO)CCO)c4c(C)c3c2c1 |
|
~47%
2-[2-hydroxyeth... CAS#:83948-13-4 |
| Literature: Rivalle, Christian; Wendling, Francoise; Tambourin, Pierre; Lhoste, Jean-Marc; Bisagni, Emile; Chermann, Jean-Claude Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 181 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |