Anhydrous magnesium mono-p-nitrobenzyl malonate structure
|
Common Name | Anhydrous magnesium mono-p-nitrobenzyl malonate | ||
|---|---|---|---|---|
| CAS Number | 83972-01-4 | Molecular Weight | 500.652 | |
| Density | N/A | Boiling Point | 455.8ºC at 760 mmHg | |
| Molecular Formula | C20H16MgN2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
| Name | Magnesium mono-p-nitrobenzyl malonate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 455.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H16MgN2O12 |
| Molecular Weight | 500.652 |
| Flash Point | 229.5ºC |
| Exact Mass | 500.055359 |
| PSA | 224.50000 |
| LogP | 0.60240 |
| InChIKey | WAFDWKYNSTVECG-UHFFFAOYSA-L |
| SMILES | O=C([O-])CC(=O)OCc1ccc([N+](=O)[O-])cc1.O=C([O-])CC(=O)OCc1ccc([N+](=O)[O-])cc1.[Mg+2] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Anhydrous Magnesium Mono-P-Nitro-Benzyl Malonate |
| Propanedioic acid, mono[(4-nitrophenyl)methyl] ester, magnesium salt (2:1) |
| Anhydrous magnesium mono-p-nitrobenzyl malonate |
| MAGNESIUM 4-NITROBENZYL MALONATE |
| Einecs 281-602-2 |
| bis[p-nitrobenzyl hydrogen malonato]magnesium |
| Magnesium (T-4)-propanedioato]-bis[mono[(4-nitrophenyl)methyl] |
| Magnesium mono-4-nitrobenzyl malonate |
| MFCD00060141 |
| Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} |
| ANHYDROUSMAGNESIUMMONO-4-NITROBENZYLMALONATE |
| Magnesium salt ascorbic acid phosphate |