Relaton-Oral structure
|
Common Name | Relaton-Oral | ||
|---|---|---|---|---|
| CAS Number | 84-19-5 | Molecular Weight | 350.408 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 451.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C22H22O4 | Melting Point | 122°C | |
| MSDS | N/A | Flash Point | 220.0±21.6 °C | |
Use of Relaton-OralDienestrol diacetate is a derivative of the synthetic non-steroid phenolic compound, DIENESTROL, which exhibits estrogenic activities. |
| Name | 3,4-Bis(4-acetoxyphenyl)-2,4-hexadiene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.5±25.0 °C at 760 mmHg |
| Melting Point | 122°C |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.408 |
| Flash Point | 220.0±21.6 °C |
| Exact Mass | 350.151794 |
| PSA | 52.60000 |
| LogP | 5.36 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | YWLLGDVBTLPARJ-UHFFFAOYSA-N |
| SMILES | CC=C(C(=CC)c1ccc(OC(C)=O)cc1)c1ccc(OC(C)=O)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn: Harmful;F: Flammable; |
|---|---|
| Risk Phrases | 36/37/38-48-40-36-20/21/22-11 |
| Safety Phrases | S26-S36/37/39-S24/25-S22-S36/37 |
| RIDADR | UN 2811 6.1/PG 2 |
| RTECS | SL0590000 |
| HS Code | 2916399090 |
|
~%
Relaton-Oral CAS#:84-19-5 |
|
Literature: US2421402 , ; Svedberg-Festschr. |
|
~%
Relaton-Oral CAS#:84-19-5 |
| Literature: US2421402 , ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 201-520-2 |
| MFCD00063286 |
| (2E,4E)-2,4-Hexadiene-3,4-diyldi-4,1-phenylene diacetate |
| Relaton-Oral |
| DIENESTROL DIACETATE |
| (2E,4E)-Hexa-2,4-diene-3,4-diyldi-4,1-phenylene diacetate |
| Phenol, 4,4'-[(1E,2E)-1,2-diethylidene-1,2-ethanediyl]bis-, diacetate |