2-Ethyl-9,10-anthraquinone structure
|
Common Name | 2-Ethyl-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 84-51-5 | Molecular Weight | 236.265 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 415.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H12O2 | Melting Point | 108-111 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 155.4±22.9 °C | |
| Symbol |
GHS08, GHS09 |
Signal Word | Warning | |
| Name | 2-Ethyl anthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.4±35.0 °C at 760 mmHg |
| Melting Point | 108-111 °C(lit.) |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.265 |
| Flash Point | 155.4±22.9 °C |
| Exact Mass | 236.083725 |
| PSA | 34.14000 |
| LogP | 4.38 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | SJEBAWHUJDUKQK-UHFFFAOYSA-N |
| SMILES | CCc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H373-H410 |
| Precautionary Statements | P273-P501 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xn |
| Risk Phrases | R22 |
| Safety Phrases | S24/25 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 1 |
| RTECS | CB0525000 |
| Packaging Group | II; III |
| Hazard Class | 4.1 |
| HS Code | 2914610000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 201-535-4 |
| 9,10-Anthracenedione, 2-ethyl- |
| 2-Ethyl-9,10-anthraquinone |
| 2-Ethyl-9,10-anthracenedione |
| 2-ethylanthracene-9,10-dione |
| MFCD00001237 |
| 2-Ethylanthra-9,10-quinone |
| L C666 BV IVJ E2 |
| 2-Ethylanthraquinone |