bis(2-hydroxyethyl) phthalate structure
|
Common Name | bis(2-hydroxyethyl) phthalate | ||
|---|---|---|---|---|
| CAS Number | 84-73-1 | Molecular Weight | 254.23600 | |
| Density | 1.315 g/cm3 | Boiling Point | 417.2ºC at 760 mmHg | |
| Molecular Formula | C12H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.2°C | |
| Name | bis(2-hydroxyethyl) benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315 g/cm3 |
|---|---|
| Boiling Point | 417.2ºC at 760 mmHg |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.23600 |
| Flash Point | 159.2°C |
| Exact Mass | 254.07900 |
| PSA | 93.06000 |
| Index of Refraction | 1.556 |
| InChIKey | CAKVXHUYTFYBPK-UHFFFAOYSA-N |
| SMILES | O=C(OCCO)c1ccccc1C(=O)OCCO |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| einecs 201-556-9 |