1,1'-methylenebisnaphthalene-2-sulphonic acid
1,1'-methylenebisnaphthalene-2-sulphonic acid structure
|
Common Name | 1,1'-methylenebisnaphthalene-2-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 84-90-2 | Molecular Weight | 428.47800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,1'-Methylenebisnaphthalene-2-sulphonic acid (Chinese name: 1,1'-甲烯双(2-萘磺酸)），CAS number: 84-90-2，molecular formula: C21H16O6S2。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Naphthalenesulfonic acid, 1,1'-methylenebis |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H16O6S2 |
|---|---|
| Molecular Weight | 428.47800 |
| Exact Mass | 428.03900 |
| PSA | 125.50000 |
| LogP | 6.23880 |
| InChIKey | DQBNLFRFALCILS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2ccccc2c1Cc1c(S(=O)(=O)O)ccc2ccccc12 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-[(2-sulfonaphthalen-1-yl)methyl]naphthalene-2-sulfonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: CAS number of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is 84-90-2. |
| Q: What is the LogP of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: LogP of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is 6.23880. |
| Q: What is the English name of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: The English name of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is 2-Naphthalenesulfonic acid, 1,1'-methylenebis. |
| Q: What is the molecular formula of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: Molecular formula of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is C21H16O6S2. |
| Q: What is the Chinese name of 84-90-2? |
| A: Chinese name of 84-90-2 is 84-90-2. |
| Q: What is the molecular weight of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: Molecular weight of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is 428.47800. |
| Q: What is the polar surface area (PSA) of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: Polar surface area (PSA) of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is 125.50000. |
| Q: What is the InChIKey of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: InChIKey of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is DQBNLFRFALCILS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-Naphthalenesulfonic acid, 1,1'-methylenebis? |
| A: SMILES notation of 2-Naphthalenesulfonic acid, 1,1'-methylenebis is O=S(=O)(O)c1ccc2ccccc2c1Cc1c(S(=O)(=O)O)ccc2ccccc12. |
| Q: What English synonyms does 2-Naphthalenesulfonic acid, 1,1'-methylenebis have? |
| A: English synonyms of 2-Naphthalenesulfonic acid, 1,1'-methylenebis: 1-[(2-sulfonaphthalen-1-yl)methyl]naphthalene-2-sulfonic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |