(S)-11-DimethoxyMethyl-4-ethyl-4-hydroxy-1,12-dihydro-4H-2-oxa-6,12a-diaza-dibenzo[b,h]fluorene-3,13-dione structure
|
Common Name | (S)-11-DimethoxyMethyl-4-ethyl-4-hydroxy-1,12-dihydro-4H-2-oxa-6,12a-diaza-dibenzo[b,h]fluorene-3,13-dione | ||
|---|---|---|---|---|
| CAS Number | 84017-99-2 | Molecular Weight | 422.43100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4S)-11-(Dimethoxymethyl)-4-ethyl-4-hydroxy-1H-pyrano[3',4':6,7]i ndolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H22N2O6 |
|---|---|
| Molecular Weight | 422.43100 |
| Exact Mass | 422.14800 |
| PSA | 99.88000 |
| LogP | 2.37100 |
| InChIKey | REONBJNSUPDLMU-QHCPKHFHSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2C(OC)OC |
|
~84%
(S)-11-Dimethox... CAS#:84017-99-2 |
| Literature: Giannini, Giuseppe; Marzi, Mauro; Cabri, Walter; Marastoni, Elena; Battistuzzi, Gianfranco; Vesci, Loredana; Pisano, Claudio; Beretta, Giovanni Luca; Cesare, Michelandrea De; Zunino, Franco Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 9 p. 2910 - 2915 |
|
~%
(S)-11-Dimethox... CAS#:84017-99-2 |
| Literature: SIGMA-TAU INDUSTRIE FARMACEUTICHE RIUNITE S.P.A. Patent: WO2009/16068 A1, 2009 ; Location in patent: Page/Page column 8 ; |
|
~16%
(S)-11-Dimethox... CAS#:84017-99-2 |
| Literature: Sawada; Nokata; Furuta; Yokokura; Miyasaka Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 10 p. 2574 - 2580 |
|
~%
(S)-11-Dimethox... CAS#:84017-99-2 |
| Literature: THRESHOLD PHARMACEUTICALS, INC.; CAI, Xiaohong; DUAN, Jian-Xin; MATTEUCCI, Mark; CAO, Yeyu; JIAO, Hailong Patent: WO2010/148138 A2, 2010 ; Location in patent: Page/Page column 68-69 ; WO 2010/148138 A2 |
| 7-dimethoxymethyl-1,3,5-cycloheptatriene |
| cyclohepta-2,4,6-trienecarbaldehyde dimethylacetal |
| Cycloheptatrien-7-carboxaldehyd-dimethylacetal |
| Cyclohepta-2,4,6-triencarbaldehyd-dimethylacetal |
| Cyclohepta-2,4,6-trien-1-carbaldehyd-dimethylacetal |
| 7-formyl-camptothecin dimethylacetal |
| 7-Dimethoxymethylcycloheptatrien |
| 7-dimethyl-acetal camptothecin |
| 7-Dimethoxymethylcamptothecin |