Bis(4-methoxyphenyl)phosphine structure
|
Common Name | Bis(4-methoxyphenyl)phosphine | ||
|---|---|---|---|---|
| CAS Number | 84127-04-8 | Molecular Weight | 246.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15O2P | Melting Point | 36-40 °C | |
| MSDS | Chinese USA | Flash Point | >110℃ | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | Bis(4-methoxyphenyl)phosphine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 36-40 °C |
|---|---|
| Molecular Formula | C14H15O2P |
| Molecular Weight | 246.24100 |
| Flash Point | >110℃ |
| Exact Mass | 246.08100 |
| PSA | 32.05000 |
| LogP | 2.33310 |
| InChIKey | FWKICRREDMVWRF-UHFFFAOYSA-N |
| SMILES | COc1ccc(Pc2ccc(OC)cc2)cc1 |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H228-H315-H319-H335 |
| Precautionary Statements | P210-P261-P305 + P351 + P338 |
| Hazard Codes | F |
| Risk Phrases | 11-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | 1325 |
| Packaging Group | Ⅱ |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| bis(4-methoxyphenyl)phosphane |