tetrahydro-2,4-dimethyl-6-phenyl-2H-pyran-4-ol structure
|
Common Name | tetrahydro-2,4-dimethyl-6-phenyl-2H-pyran-4-ol | ||
|---|---|---|---|---|
| CAS Number | 84145-51-7 | Molecular Weight | 206.28100 | |
| Density | 1.046g/cm3 | Boiling Point | 332.5ºC at 760 mmHg | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.3ºC | |
| Name | 2,4-dimethyl-6-phenyloxan-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.046g/cm3 |
|---|---|
| Boiling Point | 332.5ºC at 760 mmHg |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28100 |
| Flash Point | 143.3ºC |
| Exact Mass | 206.13100 |
| PSA | 29.46000 |
| LogP | 2.67760 |
| Index of Refraction | 1.521 |
| InChIKey | GTDWBOZGGBDJGL-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(O)CC(c2ccccc2)O1 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyran-4-ol,tetrahydro-2,4-dimethyl-6-phenyl-(6CI) |
| 2H-Pyran-4-ol,tetrahydro-2,4-dimethyl-6-phenyl |
| EINECS 282-278-5 |
| 2,4-Dimethyl-6-phenyl-tetrahydro-pyran-4-ol |