diethyl 2-(2-(pyridin-2-yl)ethyl)malonate structure
|
Common Name | diethyl 2-(2-(pyridin-2-yl)ethyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 84199-92-8 | Molecular Weight | 265.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-(2-pyridin-2-ylethyl)propanedioate |
|---|
| Molecular Formula | C14H19NO4 |
|---|---|
| Molecular Weight | 265.30500 |
| Exact Mass | 265.13100 |
| PSA | 65.49000 |
| LogP | 1.75660 |
| InChIKey | XVPMESFRZJJXGY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCc1ccccn1)C(=O)OCC |
|
~91%
diethyl 2-(2-(p... CAS#:84199-92-8 |
| Literature: Mayer, Joachim M.; Testa, Bernard Helvetica Chimica Acta, 1982 , vol. 65, # 6 p. 1868 - 1884 |
|
~%
diethyl 2-(2-(p... CAS#:84199-92-8 |
| Literature: Menghin, Sonja; Pertz, Heinz H.; Kramer, Kai; Seifert, Roland; Schunack, Walter; Elz, Sigurd Journal of Medicinal Chemistry, 2003 , vol. 46, # 25 p. 5458 - 5470 |
|
~%
Detail
|
| Literature: Boekelheide; Rothchild Journal of the American Chemical Society, 1949 , vol. 71, p. 879,882 |
| Precursor 5 | |
|---|---|
| DownStream 8 | |