2,6-ditert-butyl-4-(2-methylsulfanyl-1H-imidazol-5-yl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(2-methylsulfanyl-1H-imidazol-5-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 84203-46-3 | Molecular Weight | 318.47700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(2-methylsulfanyl-1H-imidazol-5-yl)phenol |
|---|
| Molecular Formula | C18H26N2OS |
|---|---|
| Molecular Weight | 318.47700 |
| Exact Mass | 318.17700 |
| PSA | 74.21000 |
| LogP | 5.09920 |
| InChIKey | PHPVPNDIKPXLHJ-UHFFFAOYSA-N |
| SMILES | CSc1ncc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)[nH]1 |
|
~39%
2,6-ditert-buty... CAS#:84203-46-3 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
|
~%
2,6-ditert-buty... CAS#:84203-46-3 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
|
~%
2,6-ditert-buty... CAS#:84203-46-3 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
|
~%
2,6-ditert-buty... CAS#:84203-46-3 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |