1-[3-(4-nitrophenoxy)propyl]-4-phenylpiperidine structure
|
Common Name | 1-[3-(4-nitrophenoxy)propyl]-4-phenylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 84344-66-1 | Molecular Weight | 340.41600 | |
| Density | 1.15g/cm3 | Boiling Point | 504.9ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.1ºC | |
| Name | 1-[3-(4-nitrophenoxy)propyl]-4-phenylpiperidine |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 504.9ºC at 760 mmHg |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.41600 |
| Flash Point | 259.1ºC |
| Exact Mass | 340.17900 |
| PSA | 58.29000 |
| LogP | 4.70440 |
| Index of Refraction | 1.575 |
| InChIKey | MJLMIVQYZHTAHO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCCN2CCC(c3ccccc3)CC2)cc1 |
|
~%
1-[3-(4-nitroph... CAS#:84344-66-1 |
| Literature: Agarwal, Shiv K.; Kumar, Yatendra; Saxena, Anil K.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 5 p. 435 - 439 |
|
~%
1-[3-(4-nitroph... CAS#:84344-66-1 |
| Literature: Agarwal, Shiv K.; Kumar, Yatendra; Saxena, Anil K.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 5 p. 435 - 439 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |