Flavin adenine dinucleotide disodium salt structure
|
Common Name | Flavin adenine dinucleotide disodium salt | ||
|---|---|---|---|---|
| CAS Number | 84366-81-4 | Molecular Weight | 829.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H31N9Na2O15P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Flavin adenine dinucleotide disodium saltFlavin Adenine Dinucleotide Disodium is a redox cofactor, more specifically a prosthetic group of a protein, involved in several important enzymatic reactions in metabolism. |
| Name | Flavin adenine dinucleotide disodium salt |
|---|---|
| Synonym | More Synonyms |
| Description | Flavin Adenine Dinucleotide Disodium is a redox cofactor, more specifically a prosthetic group of a protein, involved in several important enzymatic reactions in metabolism. |
|---|---|
| Related Catalog | |
| In Vitro | Poly(Flavin Adenine Dinucleotide, FAD) characterized by an additional polymer-type redox reaction is a highly effective electrocatalyst for NADH oxidation: operating at the lowest potentials reported for NADH transducers (0.00 V, pH 7.4), poly(FAD) is characterized by the electrochemical rate constant of 1.8 ± 0.6×10-3 cm/s, which is at the level of the NADH mass-transfer constant. Poly(FAD)-modified electrodes are characterized by the dramatically improved stability and, is the most advantageous NADH transducers for analytical chemistry[2]. |
| In Vivo | With flavin adenine dinucleotide (2 mg/kg), the chlorpromazine (CPZ)-induced decrease in ventricular fibrillation threshold (VFT) is significantly cancelled. Flavin Adenine Dinucleotide cancels the effect of CPZ on canine heart mitochondria. After injection of Flavin Adenine Dinucleotide, the dogs show a transient hypotension within 10 min, then their blood pressures recover to the initial level. Flavin Adenine Dinucleotide also prevents mitochondrial dysfunction induced by chlorpromazine[1]. |
| References |
| Molecular Formula | C27H31N9Na2O15P2 |
|---|---|
| Molecular Weight | 829.51 |
| PSA | 397.44000 |
| InChIKey | XLRHXNIVIZZOON-WFUPGROFSA-L |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)COP(=O)([O-])OP(=O)([O-])OCC3OC(n4cnc5c(N)ncnc54)C(O)C3O)c2cc1C.[Na+].[Na+] |
| Storage condition | 2-8°C |
| Water Solubility | 5 g/L |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S24/25-S22 |
| WGK Germany | 3 |
| Flavaspidic acid |
| Polystichocitrin |
| MFCD00151217 |
| 5'->5'-ester with adenosine,disodium salt |
| Toxifren |
| Glavaspidic acid |
| Flavaspidsaeure |
| flavaspidic acid AB |
| EINECS 282-733-8 |
| Flavaspidic acid BB |
| flavin-adenin dinucleotide,disodium salt |
| flaspidic acid-BBBB |
| flavine-adenine-dinucleotide disodium-salt |