alpha-Arbutin structure
|
Common Name | alpha-Arbutin | ||
|---|---|---|---|---|
| CAS Number | 84380-01-8 | Molecular Weight | 272.251 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 561.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O7 | Melting Point | 195-196ºC | |
| MSDS | USA | Flash Point | 293.4±30.1 °C | |
Use of alpha-Arbutinα-Arbutin (4-Hydroxyphenyl α-D-glucopyranoside) is emerging as popular and effective skin whiteners, acting as tyrosinase inhibitor[1]. |
| Name | alpha arbutin |
|---|---|
| Synonym | More Synonyms |
| Description | α-Arbutin (4-Hydroxyphenyl α-D-glucopyranoside) is emerging as popular and effective skin whiteners, acting as tyrosinase inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.6±50.0 °C at 760 mmHg |
| Melting Point | 195-196ºC |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.251 |
| Flash Point | 293.4±30.1 °C |
| Exact Mass | 272.089600 |
| PSA | 119.61000 |
| LogP | -1.35 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | BJRNKVDFDLYUGJ-ZIQFBCGOSA-N |
| SMILES | OCC1OC(Oc2ccc(O)cc2)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2938909090 |
| HS Code | 2938909090 |
|---|
| α-D-Glucopyranoside, 4-hydroxyphenyl |
| 4-Hydroxyphenyl-β-glucopyranoside |
| (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-(4-hydroxyphenoxy)tetrahydro-2H-pyran-3,4,5-triol |
| 4-Hydroxyphenyl β-D-glucopyranoside |
| 4-Hydroxyphenyl a-D-glucopyranoside |
| b-Arbutin |
| Arbutin |
| 4-Hydroxyphenyl-β-D-glucopyranoside |
| hydroquinone O-β-D-glucopyranoside |
| Hydroquinone-b-D-glucopyranoside |
| p-Hydroxyphenyl β-D-glucopyranoside |
| (2R,3S,4S,5R,6S)-2-(Hydroxyméthyl)-6-(4-hydroxyphénoxy)tétrahydro-2H-pyran-3,4,5-triol |
| 4-Hydroxyphenyl-b-D-glucopyranoside |
| Hydroquinone-β-D-glucopyranoside |
| α-Arbutin |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol |
| 4-Hydroxyphenyl α-D-glucopyranoside |
| β-D-Glucopyranoside, 4-hydroxyphenyl |