4-(2,4,6-trimethylphenyl)but-3-en-2-ol structure
|
Common Name | 4-(2,4,6-trimethylphenyl)but-3-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 84473-23-4 | Molecular Weight | 190.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,4,6-trimethylphenyl)but-3-en-2-ol |
|---|
| Molecular Formula | C13H18O |
|---|---|
| Molecular Weight | 190.28100 |
| Exact Mass | 190.13600 |
| PSA | 20.23000 |
| LogP | 3.00580 |
| InChIKey | ZJFCIKGDWHASJI-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C=CC(C)O)c(C)c1 |
|
~%
4-(2,4,6-trimet... CAS#:84473-23-4 |
| Literature: Bharucha; Weedon Journal of the Chemical Society, 1953 , p. 1571,1576 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |