(3-chloro-5-fluorophenyl)-(4-chlorophenyl)methanone structure
|
Common Name | (3-chloro-5-fluorophenyl)-(4-chlorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 844885-02-5 | Molecular Weight | 269.09800 | |
| Density | 1.375g/cm3 | Boiling Point | 380.5ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl2FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.9ºC | |
| Name | (3-chloro-5-fluorophenyl)-(4-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 380.5ºC at 760 mmHg |
| Molecular Formula | C13H7Cl2FO |
| Molecular Weight | 269.09800 |
| Flash Point | 183.9ºC |
| Exact Mass | 267.98600 |
| PSA | 17.07000 |
| LogP | 4.36350 |
| Index of Refraction | 1.587 |
| InChIKey | PQJLIPSXWYRIBF-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1cc(F)cc(Cl)c1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3',4-dichloro-5'-fluorobenzophenone |