4,6-diphenyl-1,3-thiazine-2-thione structure
|
Common Name | 4,6-diphenyl-1,3-thiazine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 84512-72-1 | Molecular Weight | 281.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-diphenyl-1,3-thiazine-2-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11NS2 |
|---|---|
| Molecular Weight | 281.39500 |
| Exact Mass | 281.03300 |
| PSA | 73.22000 |
| LogP | 5.20660 |
| InChIKey | XJUVEWADHSDHPV-UHFFFAOYSA-N |
| SMILES | S=c1nc(-c2ccccc2)cc(-c2ccccc2)s1 |
|
~70%
4,6-diphenyl-1,... CAS#:84512-72-1 |
| Literature: Schroth, Werner; Spitzner, Roland; Freitag, Joerg Synthesis, 1983 , # 10 p. 827 - 830 |
|
~%
4,6-diphenyl-1,... CAS#:84512-72-1 |
| Literature: Nishio, Takehiko; Omote, Yoshimori Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 9 p. 2149 - 2152 |
|
~%
4,6-diphenyl-1,... CAS#:84512-72-1 |
| Literature: Nishio, Takehiko; Omote, Yoshimori Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 9 p. 2149 - 2152 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,6-Diphenyl-1,3-thiazin-2-thion |
| 2H-1,3-Thiazine-2-thione,4,6-diphenyl |