1-(4-methylphenyl)-4,6-diphenylpyrimidin-2-one structure
|
Common Name | 1-(4-methylphenyl)-4,6-diphenylpyrimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 72923-17-2 | Molecular Weight | 338.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methylphenyl)-4,6-diphenylpyrimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H18N2O |
|---|---|
| Molecular Weight | 338.40200 |
| Exact Mass | 338.14200 |
| PSA | 34.89000 |
| LogP | 4.87490 |
| InChIKey | XEIAFVUDGFSBCF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cc(-c3ccccc3)nc2=O)cc1 |
|
~%
1-(4-methylphen... CAS#:72923-17-2 |
| Literature: Nishio, Takehiko; Omote, Yoshimori Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 239 - 242 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 4,6-diphenyl-1-p-tolylpyrimidin-2(1H)-one |
| 1-(4-methylphenyl)-4,6-diphenyl-2(1H)-pyrimidinone |
| 2(1H)-Pyrimidinone,1-(4-methylphenyl)-4,6-diphenyl |
| 4,6-diphenyl-1-p-tolyl-1H-pyrimidin-2-one |