3-nitro-6,7-dihydro-5h-cyclopenta[b]pyridine structure
|
Common Name | 3-nitro-6,7-dihydro-5h-cyclopenta[b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 84531-36-2 | Molecular Weight | 164.16100 | |
| Density | 1.328g/cm3 | Boiling Point | 277.921ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.882ºC | |
| Name | 3-nitro-6,7-dihydro-5h-cyclopenta[b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 277.921ºC at 760 mmHg |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16100 |
| Flash Point | 121.882ºC |
| Exact Mass | 164.05900 |
| PSA | 58.71000 |
| LogP | 2.00170 |
| Index of Refraction | 1.614 |
| InChIKey | MOSHQQPJHRYIHH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc2c(c1)CCC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5H-1-Pyrindine,6,7-dihydro-3-nitro |
| 6,7-dihydro-3-nitro-5H-1-pyrindine |
| 6,7-dihydro-3-nitro-5H-cyclopenta<b>pyridine |