Trans-1,2-bis(perfluoro-n-butyl)ethylene structure
|
Common Name | Trans-1,2-bis(perfluoro-n-butyl)ethylene | ||
|---|---|---|---|---|
| CAS Number | 84551-43-9 | Molecular Weight | 464.09400 | |
| Density | 1.675 | Boiling Point | 64,3ºC 56mm | |
| Molecular Formula | C10H2F18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 52.3ºC | |
| Name | bis(perfluorobutyl)ethene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.675 |
|---|---|
| Boiling Point | 64,3ºC 56mm |
| Molecular Formula | C10H2F18 |
| Molecular Weight | 464.09400 |
| Flash Point | 52.3ºC |
| Exact Mass | 463.98700 |
| LogP | 6.47900 |
| Index of Refraction | 1.3 |
| InChIKey | FSOCDJTVKIHJDC-OWOJBTEDSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2903399090 |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| TRANS-1,2-BIS(PERFLUORO-N-BUTYL)ETHYLENE |
| 5H,6H-PERFLUORODEC-5-ENE |
| 5H,6H-octadecafluoro-dec-5-ene |
| MFCD00055550 |
| F-5H,6H-n-Decene-5 |
| TRANS-5H,6H-PERFLUORODEC-5-ENE |
| Bisperfluoronbutylethylene |
| perfluoro-5,6-dihydro-5-decene |
| 5H,6H-F-n-decene-5 |