PHA 767491 hydrochloride structure
|
Common Name | PHA 767491 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 845538-12-7 | Molecular Weight | 249.69600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClN3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of PHA 767491 hydrochloridePHA 767491 hydrochloride is a potent and selective ATP-competitive dual inhibitor cdc7/cdk9. PHA-767491 blocks DNA synthesis and affects the phosphorylation of the replicative DNA helicase at Cdc7-dependent phosphorylation sites. |
| Name | 2-pyridin-4-yl-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12ClN3O |
|---|---|
| Molecular Weight | 249.69600 |
| Exact Mass | 249.06700 |
| PSA | 61.27000 |
| LogP | 2.17500 |
| InChIKey | IMVNFURYBZMFDZ-UHFFFAOYSA-N |
| SMILES | Cl.O=C1NCCc2[nH]c(-c3ccncc3)cc21 |
| RIDADR | NONH for all modes of transport |
|---|
| y0371 |