Glucodichotomine B
Modify Date: 2025-09-13 07:52:24
Glucodichotomine B structure
|
Common Name | Glucodichotomine B | ||
|---|---|---|---|---|
| CAS Number | 845673-16-7 | Molecular Weight | 434.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glucodichotomine BGlucodichotomine B (Compound 13) is a natural product which can be isolated from the roots of Chinese medicinal plant Stellaria dichotoma L. var. lanceolata. Glucodichotomine B shows antitumor activity[1]. |
| Name | Glucodichotomine B |
|---|
| Description | Glucodichotomine B (Compound 13) is a natural product which can be isolated from the roots of Chinese medicinal plant Stellaria dichotoma L. var. lanceolata. Glucodichotomine B shows antitumor activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Glucodichotomine B (Compound 13) exhibits cytotoxicity towards HCT116 and SMMC7721 cells with IC50 values of 50.29 and 74.52 µm, respectively[1]. |
| References |
| Molecular Formula | C20H22N2O9 |
|---|---|
| Molecular Weight | 434.40 |
| InChIKey | WQKKQBMRVKDLBP-GOPHKZMVSA-N |
| SMILES | O=C(O)c1cc2c([nH]c3ccccc32)c(C(CO)OC2OC(CO)C(O)C(O)C2O)n1 |