(3,5-dichlorophenyl)-(3,4-difluorophenyl)methanone structure
|
Common Name | (3,5-dichlorophenyl)-(3,4-difluorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 845781-05-7 | Molecular Weight | 287.08900 | |
| Density | 1.436g/cm3 | Boiling Point | 390.3ºC at 760 mmHg | |
| Molecular Formula | C13H6Cl2F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.8ºC | |
| Name | (3,5-dichlorophenyl)-(3,4-difluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.436g/cm3 |
|---|---|
| Boiling Point | 390.3ºC at 760 mmHg |
| Molecular Formula | C13H6Cl2F2O |
| Molecular Weight | 287.08900 |
| Flash Point | 189.8ºC |
| Exact Mass | 285.97600 |
| PSA | 17.07000 |
| LogP | 4.50260 |
| Index of Refraction | 1.572 |
| InChIKey | WCYWSAOVPGUZPN-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)c1ccc(F)c(F)c1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,5-Dichloro-3',4'-difluorobenzophenone |
| (3,5-dichlorophenyl)(3,4-difluorophenyl)methanone |