2,2,2-trifluoro-1-(3-fluoro-4-methylphenyl)ethanone structure
|
Common Name | 2,2,2-trifluoro-1-(3-fluoro-4-methylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 845823-06-5 | Molecular Weight | 206.13700 | |
| Density | 1.306g/cm3 | Boiling Point | 200.9ºC at 760 mmHg | |
| Molecular Formula | C9H6F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 74.7ºC | |
| Name | 2,2,2-trifluoro-1-(3-fluoro-4-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 200.9ºC at 760 mmHg |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.13700 |
| Flash Point | 74.7ºC |
| Exact Mass | 206.03500 |
| PSA | 17.07000 |
| LogP | 2.87910 |
| Index of Refraction | 1.439 |
| InChIKey | GMGYOGJDXAFXGX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(F)(F)F)cc1F |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3'-Fluoro-4'-methyl-2,2,2-trifluoroacetophenone |
| 4'-Methyl-2,2,2,3'-tetrafluoroacetophenone |