Phenol,2-bromo-, 1-(4-methylbenzenesulfonate) structure
|
Common Name | Phenol,2-bromo-, 1-(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 84672-48-0 | Molecular Weight | 327.19400 | |
| Density | 1.517g/cm3 | Boiling Point | 432.6ºC at 760mmHg | |
| Molecular Formula | C13H11BrO3S | Melting Point | 76 °C | |
| MSDS | N/A | Flash Point | 215.5ºC | |
| Name | (2-bromophenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 432.6ºC at 760mmHg |
| Melting Point | 76 °C |
| Molecular Formula | C13H11BrO3S |
| Molecular Weight | 327.19400 |
| Flash Point | 215.5ºC |
| Exact Mass | 325.96100 |
| PSA | 51.75000 |
| LogP | 4.60600 |
| Index of Refraction | 1.606 |
| InChIKey | ZXJVRRGBOXUFSQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2Br)cc1 |
|
~90%
Phenol,2-bromo-... CAS#:84672-48-0 |
| Literature: Baker, Robert W.; Baker, Teresa M. (nee Nicoletti); Birkbeck, Anthony A.; Giles, Robin G. F.; Sargent, Melvyn V.; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 6 p. 1589 - 1600 |
| 2-bromophenyl toluene-p-sulphonate |
| 2-bromophenyl 4-methylbenzenesulfonate |
| toluene-4-sulfonic acid-(2-bromo-phenyl ester) |
| 2-tosyloxybromobenzenen |
| 2-bromophenyl toluene-p-sulfonate |
| 1-bromophenyl 4-methylbenzenesulfonate |
| 2-tosyloxybromobenzene |