1-(Benzyloxycarbonylamino)cyclopropyl-1-carboxylic acid structure
|
Common Name | 1-(Benzyloxycarbonylamino)cyclopropyl-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 84677-06-5 | Molecular Weight | 235.236 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 449.0±34.0 °C at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | 159 °C | |
| MSDS | Chinese USA | Flash Point | 225.4±25.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(Cbz-Amino)Cyclopropanecarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.0±34.0 °C at 760 mmHg |
| Melting Point | 159 °C |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.236 |
| Flash Point | 225.4±25.7 °C |
| Exact Mass | 235.084457 |
| PSA | 75.63000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | KHINKCGJKZSHAJ-UHFFFAOYSA-N |
| SMILES | O=C(NC1(C(=O)O)CC1)OCc1ccccc1 |
| Storage condition | −20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~43%
1-(Benzyloxycar... CAS#:84677-06-5 |
| Literature: Chu; Claiborne; Clement; Plattner Canadian Journal of Chemistry, 1992 , vol. 70, # 5 p. 1328 - 1337 |
|
~95%
1-(Benzyloxycar... CAS#:84677-06-5 |
| Literature: Strazewski, Peter; Tamm, Christoph Synthesis, 1987 , # 3 p. 298 - 299 |
|
~%
1-(Benzyloxycar... CAS#:84677-06-5 |
| Literature: Synlett, , # 14 p. 2489 - 2492 |
|
~%
1-(Benzyloxycar... CAS#:84677-06-5 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 47, # 8 p. 2291 - 2305 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-{[(Benzyloxy)carbonyl]amino}cyclopropanecarboxylic acid |
| Z-1-Aminocyclopropane-1-carboxylic acid |
| MFCD00083285 |
| Cyclopropanecarboxylic acid, 1-[[(phenylmethoxy)carbonyl]amino]- |
| 1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid |