Flubanilate structure
|
Common Name | Flubanilate | ||
|---|---|---|---|---|
| CAS Number | 847-20-1 | Molecular Weight | 304.30800 | |
| Density | 1.197 g/cm3 | Boiling Point | 337.9ºC at 760mmHg | |
| Molecular Formula | C14H19F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1ºC | |
| Name | ethyl N-[2-(dimethylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197 g/cm3 |
|---|---|
| Boiling Point | 337.9ºC at 760mmHg |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.30800 |
| Flash Point | 158.1ºC |
| Exact Mass | 304.14000 |
| PSA | 32.78000 |
| LogP | 3.22990 |
| Index of Refraction | 1.495 |
| InChIKey | NBODAQXRWMHEBP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(CCN(C)C)c1cccc(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Flubanilate [INN] |
| UNII-G510OWF4F4 |
| Ethyl N-(2-dimethylaminoethyl)-N-[3-(trifluoromethyl)phenyl]carbamate |