Ethyl 1-(5-bromopyridin-3-yl)piperidine-4-carboxylate structure
|
Common Name | Ethyl 1-(5-bromopyridin-3-yl)piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 847406-13-7 | Molecular Weight | 313.190 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 401.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H17BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.8±28.7 °C | |
| Name | Ethyl 1-(5-bromopyridin-3-yl)piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.7±45.0 °C at 760 mmHg |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.190 |
| Flash Point | 196.8±28.7 °C |
| Exact Mass | 312.047333 |
| PSA | 42.43000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | CEZIJGBDNLFOLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(c2cncc(Br)c2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~58%
Ethyl 1-(5-brom... CAS#:847406-13-7 |
| Literature: ICOS CORPORATION Patent: WO2005/19200 A2, 2005 ; Location in patent: Page/Page column 102-103 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 1-(5-bromo-3-pyridinyl)-4-piperidinecarboxylate |
| 4-Piperidinecarboxylic acid, 1-(5-bromo-3-pyridinyl)-, ethyl ester |
| ethyl 1-(5-bromopyridin-3-yl)piperidine-4-carboxylate |