5-Nitro-2-(trifluoromethyl)benzoic acid structure
|
Common Name | 5-Nitro-2-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 847547-06-2 | Molecular Weight | 235.117 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 333.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7±27.9 °C | |
| Name | 5-Nitro-2-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.8±42.0 °C at 760 mmHg |
| Molecular Formula | C8H4F3NO4 |
| Molecular Weight | 235.117 |
| Flash Point | 155.7±27.9 °C |
| Exact Mass | 235.009247 |
| PSA | 83.12000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | XBARJDIECXHLTI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1C(F)(F)F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Nitro-2-(trifluoromethyl)benzoic acid |
| CL9048 |
| Benzoic acid, 5-nitro-2-(trifluoromethyl)- |
| 5-Nitro-2-trifluoromethylbenzoic acid |