5-(Aminomethyl)-2-(trifluoromethyl)benzoic acid structure
|
Common Name | 5-(Aminomethyl)-2-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1381846-25-8 | Molecular Weight | 219.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(Aminomethyl)-2-(trifluoromethyl)benzoic acid |
|---|
| Molecular Formula | C9H8F3NO2 |
|---|---|
| Molecular Weight | 219.16100 |
| Exact Mass | 219.05100 |
| PSA | 63.32000 |
| LogP | 2.56260 |
| InChIKey | GOLUHMDFVYNNAY-UHFFFAOYSA-N |
| SMILES | NCc1ccc(C(F)(F)F)c(C(=O)O)c1 |
|
~48%
5-(Aminomethyl)... CAS#:1381846-25-8 |
| Literature: ELI LILLY AND COMPANY Patent: US2012/157506 A1, 2012 ; Location in patent: Page/Page column 5 ; |
|
~%
5-(Aminomethyl)... CAS#:1381846-25-8 |
| Literature: ELI LILLY AND COMPANY Patent: US2012/157506 A1, 2012 ; |