(S)-4-(1-aminoethyl)-benzoic acid methyl ester hydrochloride structure
|
Common Name | (S)-4-(1-aminoethyl)-benzoic acid methyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 847728-91-0 | Molecular Weight | 215.677 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-[(1S)-1-aminoethyl]benzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14ClNO2 |
|---|---|
| Molecular Weight | 215.677 |
| Exact Mass | 215.071304 |
| PSA | 52.32000 |
| LogP | 2.99520 |
| InChIKey | XOTRLVYRAWIVLC-FJXQXJEOSA-N |
| SMILES | COC(=O)c1ccc(C(C)N)cc1.Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Methyl 4-[(1S)-1-aminoethyl]benzoate hydrochloride (1:1) |
| Benzoic acid, 4-[(1S)-1-aminoethyl]-, methyl ester, hydrochloride (1:1) |
| (S)-4-(1-aminoethyl)-benzoic acid methyl ester hydrochloride |