3-(2-methoxyethoxymethoxy)-2-methyl-1-phenylpropan-1-one structure
|
Common Name | 3-(2-methoxyethoxymethoxy)-2-methyl-1-phenylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 84784-83-8 | Molecular Weight | 252.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-methoxyethoxymethoxy)-2-methyl-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O4 |
|---|---|
| Molecular Weight | 252.30600 |
| Exact Mass | 252.13600 |
| PSA | 44.76000 |
| LogP | 2.14250 |
| InChIKey | IKCGUTRRSHDDLC-UHFFFAOYSA-N |
| SMILES | COCCOCOCC(C)C(=O)c1ccccc1 |
|
~86%
3-(2-methoxyeth... CAS#:84784-83-8 |
| Literature: Nakata, Tadashi; Tani, Yoichiro; Hatozaki, Masayoshi; Oishi, Takeshi Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 4 p. 1411 - 1415 |
|
~%
3-(2-methoxyeth... CAS#:84784-83-8 |
| Literature: Nakata, Tadashi; Tani, Yoichiro; Hatozaki, Masayoshi; Oishi, Takeshi Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 4 p. 1411 - 1415 |
|
~%
3-(2-methoxyeth... CAS#:84784-83-8 |
| Literature: Nakata, Tadashi; Tani, Yoichiro; Hatozaki, Masayoshi; Oishi, Takeshi Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 4 p. 1411 - 1415 |
| 3-hydroxy-2-methylpropiophenone methoxyethoxymethyl ether |