Tigapotide
Modify Date: 2025-08-24 09:54:25
Tigapotide structure
|
Common Name | Tigapotide | ||
|---|---|---|---|---|
| CAS Number | 848084-83-3 | Molecular Weight | 2039.14000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C82H119N21O34S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TigapotideTigapotide (PCK-3145) is an anti-tumour peptide that reduces the development of skeletal metastases associated with prostate cancer. Tigapotide induces apoptosis and reduces tumour parathyroid hormone-related peptide (PTHrP) levels[1]. |
| Name | Tigapotide [INN] |
|---|---|
| Synonym | More Synonyms |
| Description | Tigapotide (PCK-3145) is an anti-tumour peptide that reduces the development of skeletal metastases associated with prostate cancer. Tigapotide induces apoptosis and reduces tumour parathyroid hormone-related peptide (PTHrP) levels[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C82H119N21O34S3 |
|---|---|
| Molecular Weight | 2039.14000 |
| Exact Mass | 2037.74000 |
| PSA | 986.24000 |
| InChIKey | ZRXXHPDJLAQCPC-SFJRRRFZSA-N |
| SMILES | CC(=O)NCSCC(NC(=O)C(CC(N)=O)NC(=O)C(CC(=O)O)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CCC(=O)O)C(C)O)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(CSCNC(C)=O)C(=O)NC(C(=O)NC(CSCNC(C)=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)O)C(C)O)C(C)O)C(C)O |
| unii-1wz6s45s94 |
| Tigapotide |