methyl 2-bromo-3-trimethylsilylpyridine-4-carboxylate structure
|
Common Name | methyl 2-bromo-3-trimethylsilylpyridine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 848243-28-7 | Molecular Weight | 288.21300 | |
| Density | 1.32g/cm3 | Boiling Point | 321.6ºC at 760 mmHg | |
| Molecular Formula | C10H14BrNO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.3ºC | |
| Name | methyl 2-bromo-3-trimethylsilylpyridine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 321.6ºC at 760 mmHg |
| Molecular Formula | C10H14BrNO2Si |
| Molecular Weight | 288.21300 |
| Flash Point | 148.3ºC |
| Exact Mass | 286.99800 |
| PSA | 39.19000 |
| LogP | 2.17590 |
| Index of Refraction | 1.521 |
| InChIKey | KKTZOVPBJCUUMP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccnc(Br)c1[Si](C)(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-bromo-3-trimethylsilanyl-isonicotinic acid methyl ester |