1-(3-bromopropoxy)-3-methyl-2-nitrobenzene structure
|
Common Name | 1-(3-bromopropoxy)-3-methyl-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 848589-66-2 | Molecular Weight | 274.11100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-bromopropoxy)-3-methyl-2-nitrobenzene |
|---|
| Molecular Formula | C10H12BrNO3 |
|---|---|
| Molecular Weight | 274.11100 |
| Exact Mass | 273.00000 |
| PSA | 55.05000 |
| LogP | 3.59020 |
| InChIKey | QGRYHCNWUWUGRT-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OCCCBr)c1[N+](=O)[O-] |
|
~%
1-(3-bromopropo... CAS#:848589-66-2 |
| Literature: Zeng, Lei; Li, Jiaming; Muller, Michaela; Yan, Sherry; Mujtaba, Shiraz; Pan, Chongfeng; Wang, Zhiyong; Zhou, Ming-Ming Journal of the American Chemical Society, 2005 , vol. 127, # 8 p. 2376 - 2377 |