1-(3-Bromopropoxy)-2-nitrobenzene structure
|
Common Name | 1-(3-Bromopropoxy)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 104147-69-5 | Molecular Weight | 260.08500 | |
| Density | 1.516g/cm3 | Boiling Point | 131-132ºC (0.5 mmHg) | |
| Molecular Formula | C9H10BrNO3 | Melting Point | 36-39ºC | |
| MSDS | N/A | Flash Point | 174.1ºC | |
| Name | 1-(3-Bromopropoxy)-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 131-132ºC (0.5 mmHg) |
| Melting Point | 36-39ºC |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.08500 |
| Flash Point | 174.1ºC |
| Exact Mass | 258.98400 |
| PSA | 55.05000 |
| LogP | 3.28180 |
| Appearance of Characters | Crystalline Powder | Pale yellow |
| Vapour Pressure | 3.58E-05mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | HPZBIRIHQKSGGT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OCCCBr |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39 |
| HS Code | 2909309090 |
|
~72%
1-(3-Bromopropo... CAS#:104147-69-5 |
| Literature: Huang, Shao-Xu; Li, Hui-Yuan; Liu, Jun-Yan; Morisseau, Christophe; Hammock, Bruce D.; Long, Ya-Qiu Journal of Medicinal Chemistry, 2010 , vol. 53, # 23 p. 8376 - 8386 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(3-bromopropoxy)-2-nitrobenzene |
| MFCD00596660 |