1-(3-Bromopropoxy)-2-nitrobenzene
1-(3-Bromopropoxy)-2-nitrobenzene structure
|
Common Name | 1-(3-Bromopropoxy)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 104147-69-5 | Molecular Weight | 260.08500 | |
| Density | 1.516g/cm3 | Boiling Point | 131-132ºC (0.5 mmHg) | |
| Molecular Formula | C9H10BrNO3 | Melting Point | 36-39ºC | |
| MSDS | N/A | Flash Point | 174.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-Bromopropoxy)-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 131-132ºC (0.5 mmHg) |
| Melting Point | 36-39ºC |
| Molecular Formula | C9H10BrNO3 |
| Molecular Weight | 260.08500 |
| Flash Point | 174.1ºC |
| Exact Mass | 258.98400 |
| PSA | 55.05000 |
| LogP | 3.28180 |
| Appearance of Characters | Crystalline Powder | Pale yellow |
| Vapour Pressure | 3.58E-05mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | HPZBIRIHQKSGGT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OCCCBr |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39 |
| HS Code | 2909309090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
1-(3-Bromopropo... CAS#:104147-69-5 |
| Literature: Huang, Shao-Xu; Li, Hui-Yuan; Liu, Jun-Yan; Morisseau, Christophe; Hammock, Bruce D.; Long, Ya-Qiu Journal of Medicinal Chemistry, 2010 , vol. 53, # 23 p. 8376 - 8386 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:103546-10-7![2-[3-(2-nitrophenoxy)propyl]isoindole-1,3-dione structure](https://image.chemsrc.com/caspic/290/66725-23-3.png)
CAS#:66725-23-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(3-bromopropoxy)-2-nitrobenzene |
| MFCD00596660 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: Molecular weight of 1-(3-Bromopropoxy)-2-nitrobenzene is 260.08500. |
| Q: What is the polar surface area (PSA) of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: Polar surface area (PSA) of 1-(3-Bromopropoxy)-2-nitrobenzene is 55.05000. |
| Q: What is the LogP of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: LogP of 1-(3-Bromopropoxy)-2-nitrobenzene is 3.28180. |
| Q: What English synonyms does 1-(3-Bromopropoxy)-2-nitrobenzene have? |
| A: English synonyms of 1-(3-Bromopropoxy)-2-nitrobenzene: 1-(3-bromopropoxy)-2-nitrobenzene, MFCD00596660. |
| Q: What is the InChIKey of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: InChIKey of 1-(3-Bromopropoxy)-2-nitrobenzene is HPZBIRIHQKSGGT-UHFFFAOYSA-N. |
| Q: What is the melting point of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: Melting point of 1-(3-Bromopropoxy)-2-nitrobenzene is 36-39ºC. |
| Q: What is the boiling point of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: Boiling point of 1-(3-Bromopropoxy)-2-nitrobenzene is 131-132ºC (0.5 mmHg). |
| Q: What is the English name of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: The English name of 1-(3-Bromopropoxy)-2-nitrobenzene is 1-(3-Bromopropoxy)-2-nitrobenzene. |
| Q: What is the safety information for 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: Safety information for 1-(3-Bromopropoxy)-2-nitrobenzene: S37/39. |
| Q: What is the physical appearance of 1-(3-Bromopropoxy)-2-nitrobenzene? |
| A: 1-(3-Bromopropoxy)-2-nitrobenzene appears as Crystalline Powder | Pale yellow. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |