8-BOC-3,8-DIAZABICYCLO[4.2.0]OCTANE structure
|
Common Name | 8-BOC-3,8-DIAZABICYCLO[4.2.0]OCTANE | ||
|---|---|---|---|---|
| CAS Number | 848591-80-0 | Molecular Weight | 212.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 295.4±13.0 °C at 760 mmHg | |
| Molecular Formula | C11H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.5±19.8 °C | |
| Name | tert-butyl 4,7-diazabicyclo[4.2.0]octane-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 295.4±13.0 °C at 760 mmHg |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.289 |
| Flash Point | 132.5±19.8 °C |
| Exact Mass | 212.152481 |
| PSA | 41.57000 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | ITVHTQLHEQGQNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCNCC21 |
| HS Code | 2933990090 |
|---|
|
~54%
8-BOC-3,8-DIAZA... CAS#:848591-80-0 |
| Literature: Basha, Anwer; Bunnelle, William H.; Dart, Michael J.; Gallagher, Megan E.; Ji, Jianguo; Li, Tao; Pace, Jennifer M.; Ryther, Keith B.; Tietje, Karin R. Patent: US2005/65178 A1, 2005 ; Location in patent: Page/Page column 21 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 3,8-diazabicyclo[4.2.0]octane-8-carboxylate |
| 3,8-Diaza-bicyclo[4.2.0]octane-8-carboxylic Acid Tert-Butyl Ester |
| tert-butyl 3,8-diazabicyclo[4.2.0]octane-8-carboxylate |
| 3,8-Diazabicyclo[4.2.0]octane-8-carboxylic acid, 1,1-dimethylethyl ester |
| 3,8-Diazabicyclo[4.2.0]octane-8-carboxylic acid 1,1-dimethylethyl ester |