1-Ethyl-3-methylimidazolium diethyl phosphate structure
|
Common Name | 1-Ethyl-3-methylimidazolium diethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 848641-69-0 | Molecular Weight | 264.25900 | |
| Density | 1.157 | Boiling Point | N/A | |
| Molecular Formula | C10H21N2O4P | Melting Point | 19-21ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 1-Ethyl-3-methylimidazolium diethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157 |
|---|---|
| Melting Point | 19-21ºC |
| Molecular Formula | C10H21N2O4P |
| Molecular Weight | 264.25900 |
| Exact Mass | 264.12400 |
| PSA | 77.21000 |
| LogP | 1.93050 |
| Index of Refraction | n20/D 1.475 |
| InChIKey | HQWOEDCLDNFWEV-UHFFFAOYSA-M |
| SMILES | CCOP(=O)([O-])OCC.CCn1cc[n+](C)c1 |
| Storage condition | Store below +30°C. |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | 22-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN3265 8/PG 2 |
| Packaging Group | II |
| HS Code | 29332900 |
|
Determination of solubility parameters of ionic liquids and ionic liquid/solvent mixtures from intrinsic viscosity.
ChemPhysChem 15(16) , 3580-91, (2014) The total and partial solubility parameters (dispersion, polar and hydrogen-bonding solubility parameters) of ten ionic liquids were determined. Intrinsic viscosity approaches were used that encompass... |
| diethyl phosphate,1-ethyl-3-methylimidazol-3-ium |